C9H17F4N — CID 158755562
4,4,5,5-tetrafluoro-2-methyl-N-propan-2-ylpentan-2-amine (PubChem CID 158755562) has the molecular formula C9H17F4N and a molecular weight of 215.23 g/mol. Its IUPAC name is 4,4,5,5-tetrafluoro-2-methyl-N-propan-2-ylpentan-2-amine.
| Compound Name | 4,4,5,5-tetrafluoro-2-methyl-N-propan-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 158755562 |
| Molecular Formula | C9H17F4N |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 4,4,5,5-tetrafluoro-2-methyl-N-propan-2-ylpentan-2-amine |
| SMILES | CC(C)NC(C)(C)CC(F)(F)C(F)F |
| InChI | InChI=1S/C9H17F4N/c1-6(2)14-8(3,4)5-9(12,13)7(10)11/h6-7,14H,5H2,1-4H3 |
| InChIKey | CGSVYLMUBNQTFX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|