C49H54N4O2 — CID 158758745
1-benzhydryl-3-(2,6-diethylphenyl)urea;1-(2,6-diethylphenyl)-3-(1,2-diphenylethyl)urea (PubChem CID 158758745) has the molecular formula C49H54N4O2 and a molecular weight of 731.00 g/mol. Its IUPAC name is 1-benzhydryl-3-(2,6-diethylphenyl)urea;1-(2,6-diethylphenyl)-3-(1,2-diphenylethyl)urea.
| Compound Name | 1-benzhydryl-3-(2,6-diethylphenyl)urea;1-(2,6-diethylphenyl)-3-(1,2-diphenylethyl)urea |
|---|---|
| PubChem CID | 158758745 |
| Molecular Formula | C49H54N4O2 |
| Molecular Weight | 731.00 g/mol |
| Exact Mass | 730.42 |
| IUPAC Name | 1-benzhydryl-3-(2,6-diethylphenyl)urea;1-(2,6-diethylphenyl)-3-(1,2-diphenylethyl)urea |
| SMILES | CCc1cccc(CC)c1NC(=O)NC(Cc1ccccc1)c1ccccc1.CCc1cccc(CC)c1NC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O.C24H26N2O/c1-3-20-16-11-17-21(4-2)24(20)27-25(28)26-23(22-14-9-6-10-15-22)18-19-12-7-5-8-13-19;1-3-18-16-11-17-19(4-2)22(18)25-24(27)26-23(20-12-7-5-8-13-20)21-14-9-6-10-15-21/h5-17,23H,3-4,18H2,1-2H3,(H2,26,27,28);5-17,23H,3-4H2,1-2H3,(H2,25,26,27) |
| InChIKey | IOKAGGGXBWELAZ-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.00 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |