C28H31N3O2 — CID 158760772
5-morpholin-4-yl-1-[3-[3-[(E)-2-pyridin-4-ylethenyl]anilino]phenyl]pentan-1-one (PubChem CID 158760772) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 5-morpholin-4-yl-1-[3-[3-[(E)-2-pyridin-4-ylethenyl]anilino]phenyl]pentan-1-one.
| Compound Name | 5-morpholin-4-yl-1-[3-[3-[(E)-2-pyridin-4-ylethenyl]anilino]phenyl]pentan-1-one |
|---|---|
| PubChem CID | 158760772 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 5-morpholin-4-yl-1-[3-[3-[(E)-2-pyridin-4-ylethenyl]anilino]phenyl]pentan-1-one |
| SMILES | O=C(CCCCN1CCOCC1)c1cccc(Nc2cccc(/C=C/c3ccncc3)c2)c1 |
| InChI | InChI=1S/C28H31N3O2/c32-28(9-1-2-16-31-17-19-33-20-18-31)25-6-4-8-27(22-25)30-26-7-3-5-24(21-26)11-10-23-12-14-29-15-13-23/h3-8,10-15,21-22,30H,1-2,9,16-20H2/b11-10+ |
| InChIKey | ZYGLJLMOLLWOEO-ZHACJKMWSA-N |
| XLogP | 5.68 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|