C32H31F4O3S+ — CID 158764295
5,5,6,6-tetrafluoroheptyl 4-hydroxybenzoate;triphenylsulfanium (PubChem CID 158764295) has the molecular formula C32H31F4O3S+ and a molecular weight of 571.66 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoroheptyl 4-hydroxybenzoate;triphenylsulfanium.
| Compound Name | 5,5,6,6-tetrafluoroheptyl 4-hydroxybenzoate;triphenylsulfanium |
|---|---|
| PubChem CID | 158764295 |
| Molecular Formula | C32H31F4O3S+ |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | 5,5,6,6-tetrafluoroheptyl 4-hydroxybenzoate;triphenylsulfanium |
| SMILES | CC(F)(F)C(F)(F)CCCCOC(=O)c1ccc(O)cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C14H16F4O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-13(15,16)14(17,18)8-2-3-9-21-12(20)10-4-6-11(19)7-5-10/h1-15H;4-7,19H,2-3,8-9H2,1H3/q+1; |
| InChIKey | IPBGINUTBNVOPS-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|