C27H23F2O6S2+ — CID 131729979
2-benzoyloxy-1,1-difluoroethanesulfonic acid;(4-hydroxyphenyl)-diphenylsulfanium (PubChem CID 131729979) has the molecular formula C27H23F2O6S2+ and a molecular weight of 545.61 g/mol. Its IUPAC name is 2-benzoyloxy-1,1-difluoroethanesulfonic acid;(4-hydroxyphenyl)-diphenylsulfanium.
| Compound Name | 2-benzoyloxy-1,1-difluoroethanesulfonic acid;(4-hydroxyphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 131729979 |
| Molecular Formula | C27H23F2O6S2+ |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | 2-benzoyloxy-1,1-difluoroethanesulfonic acid;(4-hydroxyphenyl)-diphenylsulfanium |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)c1ccccc1.Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H14OS.C9H8F2O5S/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;10-9(11,17(13,14)15)6-16-8(12)7-4-2-1-3-5-7/h1-14H;1-5H,6H2,(H,13,14,15)/p+1 |
| InChIKey | WZEKFLUCNOULCK-UHFFFAOYSA-O |
| XLogP | 5.81 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|