C12H11N3O2 — CID 158764360
2-(6-methyl-3-pyridinyl)-1,3-oxazole;1,3-oxazole (PubChem CID 158764360) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-(6-methyl-3-pyridinyl)-1,3-oxazole;1,3-oxazole.
| Compound Name | 2-(6-methyl-3-pyridinyl)-1,3-oxazole;1,3-oxazole |
|---|---|
| PubChem CID | 158764360 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-(6-methyl-3-pyridinyl)-1,3-oxazole;1,3-oxazole |
| SMILES | Cc1ccc(-c2ncco2)cn1.c1cocn1 |
| InChI | InChI=1S/C9H8N2O.C3H3NO/c1-7-2-3-8(6-11-7)9-10-4-5-12-9;1-2-5-3-4-1/h2-6H,1H3;1-3H |
| InChIKey | IPBLJAOTCIWJRT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |