C20H22N4 — CID 158765655
1-butyl-4-[(5-methyl-1H-indazol-4-yl)methyl]pyrrolo[3,2-c]pyridine (PubChem CID 158765655) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-butyl-4-[(5-methyl-1H-indazol-4-yl)methyl]pyrrolo[3,2-c]pyridine.
| Compound Name | 1-butyl-4-[(5-methyl-1H-indazol-4-yl)methyl]pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 158765655 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1-butyl-4-[(5-methyl-1H-indazol-4-yl)methyl]pyrrolo[3,2-c]pyridine |
| SMILES | CCCCn1ccc2c(Cc3c(C)ccc4[nH]ncc34)nccc21 |
| InChI | InChI=1S/C20H22N4/c1-3-4-10-24-11-8-15-19(21-9-7-20(15)24)12-16-14(2)5-6-18-17(16)13-22-23-18/h5-9,11,13H,3-4,10,12H2,1-2H3,(H,22,23) |
| InChIKey | IPFMGJPRMBIRQL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |