C17H11Cl2Zr — CID 158773876
1H-cyclopenta[l]phenanthren-1-ide;zirconium(3+);dichloride (PubChem CID 158773876) has the molecular formula C17H11Cl2Zr and a molecular weight of 377.41 g/mol. Its IUPAC name is 1H-cyclopenta[l]phenanthren-1-ide;zirconium(3+);dichloride.
| Compound Name | 1H-cyclopenta[l]phenanthren-1-ide;zirconium(3+);dichloride |
|---|---|
| PubChem CID | 158773876 |
| Molecular Formula | C17H11Cl2Zr |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 374.93 |
| IUPAC Name | 1H-cyclopenta[l]phenanthren-1-ide;zirconium(3+);dichloride |
| SMILES | [Cl-].[Cl-].[Zr+3].c1ccc2c(c1)c1ccccc1c1[cH-]ccc21 |
| InChI | InChI=1S/C17H11.2ClH.Zr/c1-3-8-14-12(6-1)13-7-2-4-9-15(13)17-11-5-10-16(14)17;;;/h1-11H;2*1H;/q-1;;;+3/p-2 |
| InChIKey | QIXDPDCGUNPBFC-UHFFFAOYSA-L |
| XLogP | -1.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|