C11H11Sc- — CID 151166437
4,7-dimethyl-1H-inden-1-ide;scandium (PubChem CID 151166437) has the molecular formula C11H11Sc- and a molecular weight of 188.16 g/mol. Its IUPAC name is 4,7-dimethyl-1H-inden-1-ide;scandium.
| Compound Name | 4,7-dimethyl-1H-inden-1-ide;scandium |
|---|---|
| PubChem CID | 151166437 |
| Molecular Formula | C11H11Sc- |
| Molecular Weight | 188.16 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 4,7-dimethyl-1H-inden-1-ide;scandium |
| SMILES | Cc1ccc(C)c2[cH-]ccc12.[Sc] |
| InChI | InChI=1S/C11H11.Sc/c1-8-6-7-9(2)11-5-3-4-10(8)11;/h3-7H,1-2H3;/q-1; |
| InChIKey | NXYZTZPFVLMRLO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|