About 4,7-dimethyl-1H-inden-1-ide;scandium
4,7-dimethyl-1H-inden-1-ide;scandium (PubChem CID 151166437) has the molecular formula C11H11Sc-
and a molecular weight of 188.16 g/mol. Its IUPAC name is 4,7-dimethyl-1H-inden-1-ide;scandium.
Molecular Properties
| Compound Name | 4,7-dimethyl-1H-inden-1-ide;scandium |
| PubChem CID | 151166437 |
| Molecular Formula | C11H11Sc- |
| Molecular Weight | 188.16 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 4,7-dimethyl-1H-inden-1-ide;scandium |
| SMILES | Cc1ccc(C)c2[cH-]ccc12.[Sc] |
| InChI | InChI=1S/C11H11.Sc/c1-8-6-7-9(2)11-5-3-4-10(8)11;/h3-7H,1-2H3;/q-1; |
| InChIKey | NXYZTZPFVLMRLO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dimethyl-1H-inden-1-ide;scandium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-1H-inden-1-ide;scandium?
The IUPAC name of 4,7-dimethyl-1H-inden-1-ide;scandium (CID 151166437) is 4,7-dimethyl-1H-inden-1-ide;scandium.
What is the SMILES notation for 4,7-dimethyl-1H-inden-1-ide;scandium?
The canonical SMILES for 4,7-dimethyl-1H-inden-1-ide;scandium is Cc1ccc(C)c2[cH-]ccc12.[Sc].
What is the InChIKey of 4,7-dimethyl-1H-inden-1-ide;scandium?
The InChIKey is NXYZTZPFVLMRLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11.Sc/c1-8-6-7-9(2)11-5-3-4-10(8)11;/h3-7H,1-2H3;/q-1;.
What are the key properties of 4,7-dimethyl-1H-inden-1-ide;scandium?
4,7-dimethyl-1H-inden-1-ide;scandium has a molecular weight of 188.16 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-1H-inden-1-ide;scandium is sourced from PubChem (CID 151166437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).