C27H25HfP-2 — CID 87830434
4,7-dimethyl-1H-inden-1-ide;hafnium;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane (PubChem CID 87830434) has the molecular formula C27H25HfP-2 and a molecular weight of 558.96 g/mol. Its IUPAC name is 4,7-dimethyl-1H-inden-1-ide;hafnium;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane.
| Compound Name | 4,7-dimethyl-1H-inden-1-ide;hafnium;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane |
|---|---|
| PubChem CID | 87830434 |
| Molecular Formula | C27H25HfP-2 |
| Molecular Weight | 558.96 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | 4,7-dimethyl-1H-inden-1-ide;hafnium;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane |
| SMILES | Cc1ccc(C)c2[cH-]ccc12.Cc1ccccc1Pc1cc2ccccc2[cH-]1.[Hf] |
| InChI | InChI=1S/C16H14P.C11H11.Hf/c1-12-6-2-5-9-16(12)17-15-10-13-7-3-4-8-14(13)11-15;1-8-6-7-9(2)11-5-3-4-10(8)11;/h2-11,17H,1H3;3-7H,1-2H3;/q2*-1; |
| InChIKey | ORDRODLBXCWFGB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.96 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|