C16H14HfP- — CID 87865343
hafnium;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane (PubChem CID 87865343) has the molecular formula C16H14HfP- and a molecular weight of 415.75 g/mol. Its IUPAC name is hafnium;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane.
| Compound Name | hafnium;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane |
|---|---|
| PubChem CID | 87865343 |
| Molecular Formula | C16H14HfP- |
| Molecular Weight | 415.75 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | hafnium;1H-inden-1-id-2-yl-(2-methylphenyl)phosphane |
| SMILES | Cc1ccccc1Pc1cc2ccccc2[cH-]1.[Hf] |
| InChI | InChI=1S/C16H14P.Hf/c1-12-6-2-5-9-16(12)17-15-10-13-7-3-4-8-14(13)11-15;/h2-11,17H,1H3;/q-1; |
| InChIKey | JYOMIZINOSDFDX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|