C35H42N8O6S2 — CID 158774005
1-[(1-methylpiperidin-4-yl)methyl]-3-(2-nitro-5-thiophen-2-ylphenyl)urea;1-(2-nitro-5-thiophen-2-ylphenyl)-3-(piperidin-4-ylmethyl)urea (PubChem CID 158774005) has the molecular formula C35H42N8O6S2 and a molecular weight of 734.91 g/mol. Its IUPAC name is 1-[(1-methylpiperidin-4-yl)methyl]-3-(2-nitro-5-thiophen-2-ylphenyl)urea;1-(2-nitro-5-thiophen-2-ylphenyl)-3-(piperidin-4-ylmethyl)urea.
| Compound Name | 1-[(1-methylpiperidin-4-yl)methyl]-3-(2-nitro-5-thiophen-2-ylphenyl)urea;1-(2-nitro-5-thiophen-2-ylphenyl)-3-(piperidin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 158774005 |
| Molecular Formula | C35H42N8O6S2 |
| Molecular Weight | 734.91 g/mol |
| Exact Mass | 734.27 |
| IUPAC Name | 1-[(1-methylpiperidin-4-yl)methyl]-3-(2-nitro-5-thiophen-2-ylphenyl)urea;1-(2-nitro-5-thiophen-2-ylphenyl)-3-(piperidin-4-ylmethyl)urea |
| SMILES | CN1CCC(CNC(=O)Nc2cc(-c3cccs3)ccc2[N+](=O)[O-])CC1.O=C(NCC1CCNCC1)Nc1cc(-c2cccs2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N4O3S.C17H20N4O3S/c1-21-8-6-13(7-9-21)12-19-18(23)20-15-11-14(17-3-2-10-26-17)4-5-16(15)22(24)25;22-17(19-11-12-5-7-18-8-6-12)20-14-10-13(16-2-1-9-25-16)3-4-15(14)21(23)24/h2-5,10-11,13H,6-9,12H2,1H3,(H2,19,20,23);1-4,9-10,12,18H,5-8,11H2,(H2,19,20,22) |
| InChIKey | IQFXUWCOMXBQLR-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 183.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.91 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|