C18H20N4O5S — CID 70982745
4-[[(2-nitro-5-thiophen-2-ylphenyl)carbamoylamino]methyl]piperidine-1-carboxylic acid (PubChem CID 70982745) has the molecular formula C18H20N4O5S and a molecular weight of 404.45 g/mol. Its IUPAC name is 4-[[(2-nitro-5-thiophen-2-ylphenyl)carbamoylamino]methyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[[(2-nitro-5-thiophen-2-ylphenyl)carbamoylamino]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 70982745 |
| Molecular Formula | C18H20N4O5S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 4-[[(2-nitro-5-thiophen-2-ylphenyl)carbamoylamino]methyl]piperidine-1-carboxylic acid |
| SMILES | O=C(NCC1CCN(C(=O)O)CC1)Nc1cc(-c2cccs2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N4O5S/c23-17(19-11-12-5-7-21(8-6-12)18(24)25)20-14-10-13(16-2-1-9-28-16)3-4-15(14)22(26)27/h1-4,9-10,12H,5-8,11H2,(H,24,25)(H2,19,20,23) |
| InChIKey | LEWAQFYNPDDZEO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|