C12H7BrN4O4S — CID 158775072
1,2,3-benzothiadiazole;1-bromo-2,3-dinitrobenzene (PubChem CID 158775072) has the molecular formula C12H7BrN4O4S and a molecular weight of 383.18 g/mol. Its IUPAC name is 1,2,3-benzothiadiazole;1-bromo-2,3-dinitrobenzene.
| Compound Name | 1,2,3-benzothiadiazole;1-bromo-2,3-dinitrobenzene |
|---|---|
| PubChem CID | 158775072 |
| Molecular Formula | C12H7BrN4O4S |
| Molecular Weight | 383.18 g/mol |
| Exact Mass | 381.94 |
| IUPAC Name | 1,2,3-benzothiadiazole;1-bromo-2,3-dinitrobenzene |
| SMILES | O=[N+]([O-])c1cccc(Br)c1[N+](=O)[O-].c1ccc2snnc2c1 |
| InChI | InChI=1S/C6H3BrN2O4.C6H4N2S/c7-4-2-1-3-5(8(10)11)6(4)9(12)13;1-2-4-6-5(3-1)7-8-9-6/h1-3H;1-4H |
| InChIKey | IQJHFPLFTNMEAS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 112.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.18 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|