C7H7N3OS — CID 158513701
1,2,3-benzothiadiazole;formamide (PubChem CID 158513701) has the molecular formula C7H7N3OS and a molecular weight of 181.22 g/mol. Its IUPAC name is 1,2,3-benzothiadiazole;formamide.
| Compound Name | 1,2,3-benzothiadiazole;formamide |
|---|---|
| PubChem CID | 158513701 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 1,2,3-benzothiadiazole;formamide |
| SMILES | NC=O.c1ccc2snnc2c1 |
| InChI | InChI=1S/C6H4N2S.CH3NO/c1-2-4-6-5(3-1)7-8-9-6;2-1-3/h1-4H;1H,(H2,2,3) |
| InChIKey | HLJFZOGWMQHBPT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|