C19H15N5OS2 — CID 175464234
benzamide;bis(1,2,3-benzothiadiazole) (PubChem CID 175464234) has the molecular formula C19H15N5OS2 and a molecular weight of 393.50 g/mol. Its IUPAC name is benzamide;bis(1,2,3-benzothiadiazole).
| Compound Name | benzamide;bis(1,2,3-benzothiadiazole) |
|---|---|
| PubChem CID | 175464234 |
| Molecular Formula | C19H15N5OS2 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | benzamide;bis(1,2,3-benzothiadiazole) |
| SMILES | NC(=O)c1ccccc1.c1ccc2snnc2c1.c1ccc2snnc2c1 |
| InChI | InChI=1S/C7H7NO.2C6H4N2S/c8-7(9)6-4-2-1-3-5-6;2*1-2-4-6-5(3-1)7-8-9-6/h1-5H,(H2,8,9);2*1-4H |
| InChIKey | CQZVSTFGRCZWQR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |