C38H34BBr2N3O2 — CID 158780006
2,5-dibromo-4-methylpyridine;4-(3-phenylphenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinazoline (PubChem CID 158780006) has the molecular formula C38H34BBr2N3O2 and a molecular weight of 735.33 g/mol. Its IUPAC name is 2,5-dibromo-4-methylpyridine;4-(3-phenylphenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinazoline.
| Compound Name | 2,5-dibromo-4-methylpyridine;4-(3-phenylphenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinazoline |
|---|---|
| PubChem CID | 158780006 |
| Molecular Formula | C38H34BBr2N3O2 |
| Molecular Weight | 735.33 g/mol |
| Exact Mass | 733.11 |
| IUPAC Name | 2,5-dibromo-4-methylpyridine;4-(3-phenylphenyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinazoline |
| SMILES | CC1(C)OB(c2ccc(-c3nc(-c4cccc(-c5ccccc5)c4)c4ccccc4n3)cc2)OC1(C)C.Cc1cc(Br)ncc1Br |
| InChI | InChI=1S/C32H29BN2O2.C6H5Br2N/c1-31(2)32(3,4)37-33(36-31)26-19-17-23(18-20-26)30-34-28-16-9-8-15-27(28)29(35-30)25-14-10-13-24(21-25)22-11-6-5-7-12-22;1-4-2-6(8)9-3-5(4)7/h5-21H,1-4H3;2-3H,1H3 |
| InChIKey | IQYKTZXCJKOBIB-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.33 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|