C56H61N3 — CID 158780113
3-[3-methyl-2,4-bis(1,2,3,4,5,6,7,8-octamethyl-9H-acridin-10-yl)phenyl]benzonitrile (PubChem CID 158780113) has the molecular formula C56H61N3 and a molecular weight of 776.12 g/mol. Its IUPAC name is 3-[3-methyl-2,4-bis(1,2,3,4,5,6,7,8-octamethyl-9H-acridin-10-yl)phenyl]benzonitrile.
| Compound Name | 3-[3-methyl-2,4-bis(1,2,3,4,5,6,7,8-octamethyl-9H-acridin-10-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 158780113 |
| Molecular Formula | C56H61N3 |
| Molecular Weight | 776.12 g/mol |
| Exact Mass | 775.49 |
| IUPAC Name | 3-[3-methyl-2,4-bis(1,2,3,4,5,6,7,8-octamethyl-9H-acridin-10-yl)phenyl]benzonitrile |
| SMILES | Cc1c(C)c(C)c2c(c1C)Cc1c(C)c(C)c(C)c(C)c1N2c1ccc(-c2cccc(C#N)c2)c(N2c3c(C)c(C)c(C)c(C)c3Cc3c(C)c(C)c(C)c(C)c32)c1C |
| InChI | InChI=1S/C56H61N3/c1-27-31(5)39(13)52-47(35(27)9)24-48-36(10)28(2)32(6)40(14)53(48)58(52)51-22-21-46(45-20-18-19-44(23-45)26-57)56(43(51)17)59-54-41(15)33(7)29(3)37(11)49(54)25-50-38(12)30(4)34(8)42(16)55(50)59/h18-23H,24-25H2,1-17H3 |
| InChIKey | MZUQDFQZZYSIGB-UHFFFAOYSA-N |
| XLogP | 15.22 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.12 |
| LogP ≤ 5 | 15.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |