C32H44BBrN6O4 — CID 158780483
5-bromo-2-[4-(2-hydroxyethyl)piperazin-1-yl]benzonitrile;2-[4-(2-hydroxyethyl)piperazin-1-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 158780483) has the molecular formula C32H44BBrN6O4 and a molecular weight of 667.46 g/mol. Its IUPAC name is 5-bromo-2-[4-(2-hydroxyethyl)piperazin-1-yl]benzonitrile;2-[4-(2-hydroxyethyl)piperazin-1-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 5-bromo-2-[4-(2-hydroxyethyl)piperazin-1-yl]benzonitrile;2-[4-(2-hydroxyethyl)piperazin-1-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 158780483 |
| Molecular Formula | C32H44BBrN6O4 |
| Molecular Weight | 667.46 g/mol |
| Exact Mass | 666.27 |
| IUPAC Name | 5-bromo-2-[4-(2-hydroxyethyl)piperazin-1-yl]benzonitrile;2-[4-(2-hydroxyethyl)piperazin-1-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | CC1(C)OB(c2ccc(N3CCN(CCO)CC3)c(C#N)c2)OC1(C)C.N#Cc1cc(Br)ccc1N1CCN(CCO)CC1 |
| InChI | InChI=1S/C19H28BN3O3.C13H16BrN3O/c1-18(2)19(3,4)26-20(25-18)16-5-6-17(15(13-16)14-21)23-9-7-22(8-10-23)11-12-24;14-12-1-2-13(11(9-12)10-15)17-5-3-16(4-6-17)7-8-18/h5-6,13,24H,7-12H2,1-4H3;1-2,9,18H,3-8H2 |
| InChIKey | IQZZMWSYXXBKKY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|