C21H21ClN2O5S — CID 158780571
6-[3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]propanoyl]-3H-1-benzofuran-2-one (PubChem CID 158780571) has the molecular formula C21H21ClN2O5S and a molecular weight of 448.93 g/mol. Its IUPAC name is 6-[3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]propanoyl]-3H-1-benzofuran-2-one.
| Compound Name | 6-[3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]propanoyl]-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 158780571 |
| Molecular Formula | C21H21ClN2O5S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 6-[3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]propanoyl]-3H-1-benzofuran-2-one |
| SMILES | O=C1Cc2ccc(C(=O)CCN3CCN(S(=O)(=O)c4ccc(Cl)cc4)CC3)cc2O1 |
| InChI | InChI=1S/C21H21ClN2O5S/c22-17-3-5-18(6-4-17)30(27,28)24-11-9-23(10-12-24)8-7-19(25)15-1-2-16-14-21(26)29-20(16)13-15/h1-6,13H,7-12,14H2 |
| InChIKey | IRAIUJZZEUVCOA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|