C16H28SiTi+2 — CID 158789403
dimethyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane;penta-1,3-diene;titanium(2+) (PubChem CID 158789403) has the molecular formula C16H28SiTi+2 and a molecular weight of 296.35 g/mol. Its IUPAC name is dimethyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane;penta-1,3-diene;titanium(2+).
| Compound Name | dimethyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane;penta-1,3-diene;titanium(2+) |
|---|---|
| PubChem CID | 158789403 |
| Molecular Formula | C16H28SiTi+2 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | dimethyl-(1,2,3,4-tetramethylcyclopenta-2,4-dien-1-yl)silane;penta-1,3-diene;titanium(2+) |
| SMILES | C=CC=CC.CC1=CC(C)([SiH](C)C)C(C)=C1C.[Ti+2] |
| InChI | InChI=1S/C11H20Si.C5H8.Ti/c1-8-7-11(4,12(5)6)10(3)9(8)2;1-3-5-4-2;/h7,12H,1-6H3;3-5H,1H2,2H3;/q;;+2 |
| InChIKey | ISBUARIXKKGJIH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|