About (2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium
(2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium (PubChem CID 162063708) has the molecular formula C18H26SiTi
and a molecular weight of 318.36 g/mol. Its IUPAC name is (2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium.
Molecular Properties
| Compound Name | (2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium |
| PubChem CID | 162063708 |
| Molecular Formula | C18H26SiTi |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium |
| SMILES | C=CC=CC.CC1=C(C)C([SiH](C)C)c2ccccc21.[Ti] |
| InChI | InChI=1S/C13H18Si.C5H8.Ti/c1-9-10(2)13(14(3)4)12-8-6-5-7-11(9)12;1-3-5-4-2;/h5-8,13-14H,1-4H3;3-5H,1H2,2H3; |
| InChIKey | ZAEGYTILSWJXCJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium?
The IUPAC name of (2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium (CID 162063708) is (2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium.
What is the SMILES notation for (2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium?
The canonical SMILES for (2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium is C=CC=CC.CC1=C(C)C([SiH](C)C)c2ccccc21.[Ti].
What is the InChIKey of (2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium?
The InChIKey is ZAEGYTILSWJXCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Si.C5H8.Ti/c1-9-10(2)13(14(3)4)12-8-6-5-7-11(9)12;1-3-5-4-2;/h5-8,13-14H,1-4H3;3-5H,1H2,2H3;.
What are the key properties of (2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium?
(2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium has a molecular weight of 318.36 g/mol, XLogP of 5.35, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;penta-1,3-diene;titanium is sourced from PubChem (CID 162063708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).