C22H35NOSi — CID 160643924
buta-1,3-diene;(2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;2,2-dimethylpropanamide (PubChem CID 160643924) has the molecular formula C22H35NOSi and a molecular weight of 357.61 g/mol. Its IUPAC name is buta-1,3-diene;(2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;2,2-dimethylpropanamide.
| Compound Name | buta-1,3-diene;(2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 160643924 |
| Molecular Formula | C22H35NOSi |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | buta-1,3-diene;(2,3-dimethyl-1H-inden-1-yl)-dimethylsilane;2,2-dimethylpropanamide |
| SMILES | C=CC=C.CC(C)(C)C(N)=O.CC1=C(C)C([SiH](C)C)c2ccccc21 |
| InChI | InChI=1S/C13H18Si.C5H11NO.C4H6/c1-9-10(2)13(14(3)4)12-8-6-5-7-11(9)12;1-5(2,3)4(6)7;1-3-4-2/h5-8,13-14H,1-4H3;1-3H3,(H2,6,7);3-4H,1-2H2 |
| InChIKey | RJNNWVFQVYLTEX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|