About 8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide
8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide (PubChem CID 150929243) has the molecular formula C9H7NOS
and a molecular weight of 177.23 g/mol. Its IUPAC name is 8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide.
Molecular Properties
| Compound Name | 8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide |
| PubChem CID | 150929243 |
| Molecular Formula | C9H7NOS |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide |
| SMILES | NC(=O)C1C(=S)c2ccccc21 |
| InChI | InChI=1S/C9H7NOS/c10-9(11)7-5-3-1-2-4-6(5)8(7)12/h1-4,7H,(H2,10,11) |
| InChIKey | LFQZEEDYILPNTG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide?
The IUPAC name of 8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide (CID 150929243) is 8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide.
What is the SMILES notation for 8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide?
The canonical SMILES for 8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide is NC(=O)C1C(=S)c2ccccc21.
What is the InChIKey of 8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide?
The InChIKey is LFQZEEDYILPNTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NOS/c10-9(11)7-5-3-1-2-4-6(5)8(7)12/h1-4,7H,(H2,10,11).
What are the key properties of 8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide?
8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide has a molecular weight of 177.23 g/mol, XLogP of 0.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-sulfanylidenebicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide is sourced from PubChem (CID 150929243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).