C15H13NOS — CID 827179
(11R)-6,11-dihydrobenzo[c][1]benzothiepine-11-carboxamide (PubChem CID 827179) has the molecular formula C15H13NOS and a molecular weight of 255.34 g/mol. Its IUPAC name is (11R)-6,11-dihydrobenzo[c][1]benzothiepine-11-carboxamide.
| Compound Name | (11R)-6,11-dihydrobenzo[c][1]benzothiepine-11-carboxamide |
|---|---|
| PubChem CID | 827179 |
| Molecular Formula | C15H13NOS |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (11R)-6,11-dihydrobenzo[c][1]benzothiepine-11-carboxamide |
| SMILES | NC(=O)[C@@H]1c2ccccc2CSc2ccccc21 |
| InChI | InChI=1S/C15H13NOS/c16-15(17)14-11-6-2-1-5-10(11)9-18-13-8-4-3-7-12(13)14/h1-8,14H,9H2,(H2,16,17)/t14-/m1/s1 |
| InChIKey | KWMIYIVKXATREY-CQSZACIVSA-N |
| XLogP | 2.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |