C34H38N4O3S2 — CID 21153532
bis(1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-3-ethylurea);hydrate (PubChem CID 21153532) has the molecular formula C34H38N4O3S2 and a molecular weight of 614.84 g/mol. Its IUPAC name is bis(1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-3-ethylurea);hydrate.
| Compound Name | bis(1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-3-ethylurea);hydrate |
|---|---|
| PubChem CID | 21153532 |
| Molecular Formula | C34H38N4O3S2 |
| Molecular Weight | 614.84 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | bis(1-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-3-ethylurea);hydrate |
| SMILES | CCNC(=O)NC1c2ccccc2CSc2ccccc21.CCNC(=O)NC1c2ccccc2CSc2ccccc21.O |
| InChI | InChI=1S/2C17H18N2OS.H2O/c2*1-2-18-17(20)19-16-13-8-4-3-7-12(13)11-21-15-10-6-5-9-14(15)16;/h2*3-10,16H,2,11H2,1H3,(H2,18,19,20);1H2 |
| InChIKey | KWJCUEOLEVTQIH-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.84 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |