C12H17NOS — CID 142965501
ethane;4-(methylamino)-1,4-dihydroisothiochromen-3-one (PubChem CID 142965501) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is ethane;4-(methylamino)-1,4-dihydroisothiochromen-3-one.
| Compound Name | ethane;4-(methylamino)-1,4-dihydroisothiochromen-3-one |
|---|---|
| PubChem CID | 142965501 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | ethane;4-(methylamino)-1,4-dihydroisothiochromen-3-one |
| SMILES | CC.CNC1C(=O)SCc2ccccc21 |
| InChI | InChI=1S/C10H11NOS.C2H6/c1-11-9-8-5-3-2-4-7(8)6-13-10(9)12;1-2/h2-5,9,11H,6H2,1H3;1-2H3 |
| InChIKey | DTCJQMZAIHPUFV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|