C18H14N2O3S — CID 51060093
5-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 51060093) has the molecular formula C18H14N2O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is 5-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 51060093 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 5-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(C2c3ccccc3CSc3ccccc32)C(=O)N1 |
| InChI | InChI=1S/C18H14N2O3S/c21-16-15(17(22)20-18(23)19-16)14-11-6-2-1-5-10(11)9-24-13-8-4-3-7-12(13)14/h1-8,14-15H,9H2,(H2,19,20,21,22,23) |
| InChIKey | YBRMFKFEGUUZJR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|