C10H8O2S — CID 91468533
3-oxo-1,4-dihydroisothiochromene-4-carbaldehyde (PubChem CID 91468533) has the molecular formula C10H8O2S and a molecular weight of 192.24 g/mol. Its IUPAC name is 3-oxo-1,4-dihydroisothiochromene-4-carbaldehyde.
| Compound Name | 3-oxo-1,4-dihydroisothiochromene-4-carbaldehyde |
|---|---|
| PubChem CID | 91468533 |
| Molecular Formula | C10H8O2S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 3-oxo-1,4-dihydroisothiochromene-4-carbaldehyde |
| SMILES | O=CC1C(=O)SCc2ccccc21 |
| InChI | InChI=1S/C10H8O2S/c11-5-9-8-4-2-1-3-7(8)6-13-10(9)12/h1-5,9H,6H2 |
| InChIKey | AGHHDYXVCHIDCL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|