C12H14O2 — CID 144847978
1-(hydroperoxymethyl)-2,3-dimethyl-1H-indene (PubChem CID 144847978) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 1-(hydroperoxymethyl)-2,3-dimethyl-1H-indene.
| Compound Name | 1-(hydroperoxymethyl)-2,3-dimethyl-1H-indene |
|---|---|
| PubChem CID | 144847978 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1-(hydroperoxymethyl)-2,3-dimethyl-1H-indene |
| SMILES | CC1=C(C)C(COO)c2ccccc21 |
| InChI | InChI=1S/C12H14O2/c1-8-9(2)12(7-14-13)11-6-4-3-5-10(8)11/h3-6,12-13H,7H2,1-2H3 |
| InChIKey | WHTQQSBAJPGZMV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|