C21H34FN — CID 142863506
3-[(1Z)-buta-1,3-dienyl]-1,2,4-trimethyl-1H-isoquinoline;ethane;fluoromethane (PubChem CID 142863506) has the molecular formula C21H34FN and a molecular weight of 319.51 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-1,2,4-trimethyl-1H-isoquinoline;ethane;fluoromethane.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-1,2,4-trimethyl-1H-isoquinoline;ethane;fluoromethane |
|---|---|
| PubChem CID | 142863506 |
| Molecular Formula | C21H34FN |
| Molecular Weight | 319.51 g/mol |
| Exact Mass | 319.27 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-1,2,4-trimethyl-1H-isoquinoline;ethane;fluoromethane |
| SMILES | C=C/C=C\C1=C(C)c2ccccc2C(C)N1C.CC.CC.CF |
| InChI | InChI=1S/C16H19N.2C2H6.CH3F/c1-5-6-11-16-12(2)14-9-7-8-10-15(14)13(3)17(16)4;3*1-2/h5-11,13H,1H2,2-4H3;2*1-2H3;1H3/b11-6-;;; |
| InChIKey | WCOUEYPOVWURAO-QGUCZYQJSA-N |
| XLogP | 6.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.51 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|