C21H18O2 — CID 139331834
4-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-4-oxocyclohexa-2,5-dien-1-yl]-4H-naphthalen-1-one (PubChem CID 139331834) has the molecular formula C21H18O2 and a molecular weight of 302.37 g/mol. Its IUPAC name is 4-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-4-oxocyclohexa-2,5-dien-1-yl]-4H-naphthalen-1-one.
| Compound Name | 4-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-4-oxocyclohexa-2,5-dien-1-yl]-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 139331834 |
| Molecular Formula | C21H18O2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-4-oxocyclohexa-2,5-dien-1-yl]-4H-naphthalen-1-one |
| SMILES | C=C/C=C\C1=C(C)C(=O)C=CC1C1C=CC(=O)c2ccccc21 |
| InChI | InChI=1S/C21H18O2/c1-3-4-7-15-14(2)20(22)12-10-17(15)18-11-13-21(23)19-9-6-5-8-16(18)19/h3-13,17-18H,1H2,2H3/b7-4- |
| InChIKey | GBSSBIUVOARULH-DAXSKMNVSA-N |
| XLogP | 4.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|