C15H29N9 — CID 158791325
1,4,5-trimethyl-4,5-dihydrotriazole;1,4,5-trimethyltriazole;2,4,5-trimethyltriazole (PubChem CID 158791325) has the molecular formula C15H29N9 and a molecular weight of 335.46 g/mol. Its IUPAC name is 1,4,5-trimethyl-4,5-dihydrotriazole;1,4,5-trimethyltriazole;2,4,5-trimethyltriazole.
| Compound Name | 1,4,5-trimethyl-4,5-dihydrotriazole;1,4,5-trimethyltriazole;2,4,5-trimethyltriazole |
|---|---|
| PubChem CID | 158791325 |
| Molecular Formula | C15H29N9 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 1,4,5-trimethyl-4,5-dihydrotriazole;1,4,5-trimethyltriazole;2,4,5-trimethyltriazole |
| SMILES | CC1N=NN(C)C1C.Cc1nn(C)nc1C.Cc1nnn(C)c1C |
| InChI | InChI=1S/C5H11N3.2C5H9N3/c2*1-4-5(2)8(3)7-6-4;1-4-5(2)7-8(3)6-4/h4-5H,1-3H3;2*1-3H3 |
| InChIKey | ISHSLEYOTIDLRN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |