C5H10N4 — CID 118346509
N,3,5-trimethyltriazol-4-amine (PubChem CID 118346509) has the molecular formula C5H10N4 and a molecular weight of 126.16 g/mol. Its IUPAC name is N,3,5-trimethyltriazol-4-amine.
| Compound Name | N,3,5-trimethyltriazol-4-amine |
|---|---|
| PubChem CID | 118346509 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | N,3,5-trimethyltriazol-4-amine |
| SMILES | CNc1c(C)nnn1C |
| InChI | InChI=1S/C5H10N4/c1-4-5(6-2)9(3)8-7-4/h6H,1-3H3 |
| InChIKey | XSKZDWHSENZLBB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |