C20H35N3O12 — CID 158793090
[(2S,4S,5R)-3,5-dihydroxy-2-methoxy-6-[[(2S,4S,5S)-3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxymethyl]oxan-4-yl] 6-azidohexanoate (PubChem CID 158793090) has the molecular formula C20H35N3O12 and a molecular weight of 509.51 g/mol. Its IUPAC name is [(2S,4S,5R)-3,5-dihydroxy-2-methoxy-6-[[(2S,4S,5S)-3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxymethyl]oxan-4-yl] 6-azidohexanoate.
| Compound Name | [(2S,4S,5R)-3,5-dihydroxy-2-methoxy-6-[[(2S,4S,5S)-3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxymethyl]oxan-4-yl] 6-azidohexanoate |
|---|---|
| PubChem CID | 158793090 |
| Molecular Formula | C20H35N3O12 |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | [(2S,4S,5R)-3,5-dihydroxy-2-methoxy-6-[[(2S,4S,5S)-3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxymethyl]oxan-4-yl] 6-azidohexanoate |
| SMILES | COCC1O[C@H](OCC2O[C@H](OC)C(O)[C@@H](OC(=O)CCCCCN=[N+]=[N-])[C@@H]2O)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H35N3O12/c1-30-8-10-13(25)15(27)16(28)20(34-10)32-9-11-14(26)18(17(29)19(31-2)33-11)35-12(24)6-4-3-5-7-22-23-21/h10-11,13-20,25-29H,3-9H2,1-2H3/t10?,11?,13-,14-,15+,16?,17?,18+,19+,20+/m1/s1 |
| InChIKey | GVNGMCFUXRDJEV-ZTUXNTMXSA-N |
| XLogP | -1.67 |
| TPSA | 222.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|