About 4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid
4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid (PubChem CID 135215318) has the molecular formula C12H20O9
and a molecular weight of 308.28 g/mol. Its IUPAC name is 4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid |
| PubChem CID | 135215318 |
| Molecular Formula | C12H20O9 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid |
| SMILES | COCC1OC(OC)C(O)C(OC(=O)CCC(=O)O)C1O |
| InChI | InChI=1S/C12H20O9/c1-18-5-6-9(16)11(10(17)12(19-2)20-6)21-8(15)4-3-7(13)14/h6,9-12,16-17H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | MFOBAGNSJYCLIU-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid?
The IUPAC name of 4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid (CID 135215318) is 4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid.
What is the SMILES notation for 4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid?
The canonical SMILES for 4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid is COCC1OC(OC)C(O)C(OC(=O)CCC(=O)O)C1O.
What is the InChIKey of 4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid?
The InChIKey is MFOBAGNSJYCLIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O9/c1-18-5-6-9(16)11(10(17)12(19-2)20-6)21-8(15)4-3-7(13)14/h6,9-12,16-17H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid?
4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid has a molecular weight of 308.28 g/mol, XLogP of -1.50, 7 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-dihydroxy-2-methoxy-6-(methoxymethyl)oxan-4-yl]oxy-4-oxobutanoic acid is sourced from PubChem (CID 135215318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).