C15H24N3O15-3 — CID 163180208
[3,5-dihydroxy-4,6-bis[3-[hydroxy(oxido)amino]propanoyloxy]oxan-2-yl]methyl 3-[hydroxy(oxido)amino]propanoate (PubChem CID 163180208) has the molecular formula C15H24N3O15-3 and a molecular weight of 486.36 g/mol. Its IUPAC name is [3,5-dihydroxy-4,6-bis[3-[hydroxy(oxido)amino]propanoyloxy]oxan-2-yl]methyl 3-[hydroxy(oxido)amino]propanoate.
| Compound Name | [3,5-dihydroxy-4,6-bis[3-[hydroxy(oxido)amino]propanoyloxy]oxan-2-yl]methyl 3-[hydroxy(oxido)amino]propanoate |
|---|---|
| PubChem CID | 163180208 |
| Molecular Formula | C15H24N3O15-3 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | [3,5-dihydroxy-4,6-bis[3-[hydroxy(oxido)amino]propanoyloxy]oxan-2-yl]methyl 3-[hydroxy(oxido)amino]propanoate |
| SMILES | O=C(CCN([O-])O)OCC1OC(OC(=O)CCN([O-])O)C(O)C(OC(=O)CCN([O-])O)C1O |
| InChI | InChI=1S/C15H24N3O15/c19-9(1-4-16(24)25)30-7-8-12(22)14(32-10(20)2-5-17(26)27)13(23)15(31-8)33-11(21)3-6-18(28)29/h8,12-15,22-24,26,28H,1-7H2/q-3 |
| InChIKey | UVNITVMTKPGWIV-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 268.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|