C18H32N4O18 — CID 163157127
[(2R,3S,4S,5S,6R)-3,4,5-tris[3-(dihydroxyamino)propanoyloxy]-6-hydroxyoxan-2-yl]methyl 3-(dihydroxyamino)propanoate (PubChem CID 163157127) has the molecular formula C18H32N4O18 and a molecular weight of 592.46 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-3,4,5-tris[3-(dihydroxyamino)propanoyloxy]-6-hydroxyoxan-2-yl]methyl 3-(dihydroxyamino)propanoate.
| Compound Name | [(2R,3S,4S,5S,6R)-3,4,5-tris[3-(dihydroxyamino)propanoyloxy]-6-hydroxyoxan-2-yl]methyl 3-(dihydroxyamino)propanoate |
|---|---|
| PubChem CID | 163157127 |
| Molecular Formula | C18H32N4O18 |
| Molecular Weight | 592.46 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-3,4,5-tris[3-(dihydroxyamino)propanoyloxy]-6-hydroxyoxan-2-yl]methyl 3-(dihydroxyamino)propanoate |
| SMILES | O=C(CCN(O)O)OC[C@H]1O[C@@H](O)[C@@H](OC(=O)CCN(O)O)[C@@H](OC(=O)CCN(O)O)[C@H]1OC(=O)CCN(O)O |
| InChI | InChI=1S/C18H32N4O18/c23-11(1-5-19(28)29)36-9-10-15(38-12(24)2-6-20(30)31)16(39-13(25)3-7-21(32)33)17(18(27)37-10)40-14(26)4-8-22(34)35/h10,15-18,27-35H,1-9H2/t10-,15+,16+,17+,18-/m1/s1 |
| InChIKey | POEXIYIVHYMDIK-LGGLKNIISA-N |
| XLogP | -3.14 |
| TPSA | 309.46 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.46 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|