C18H26N3O16-3 — CID 163150706
[6-hydroxy-3,4-bis[3-[hydroxy(oxido)amino]propanoyloxy]-5-prop-2-enoyloxyoxan-2-yl]methyl 3-[hydroxy(oxido)amino]propanoate (PubChem CID 163150706) has the molecular formula C18H26N3O16-3 and a molecular weight of 540.41 g/mol. Its IUPAC name is [6-hydroxy-3,4-bis[3-[hydroxy(oxido)amino]propanoyloxy]-5-prop-2-enoyloxyoxan-2-yl]methyl 3-[hydroxy(oxido)amino]propanoate.
| Compound Name | [6-hydroxy-3,4-bis[3-[hydroxy(oxido)amino]propanoyloxy]-5-prop-2-enoyloxyoxan-2-yl]methyl 3-[hydroxy(oxido)amino]propanoate |
|---|---|
| PubChem CID | 163150706 |
| Molecular Formula | C18H26N3O16-3 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | [6-hydroxy-3,4-bis[3-[hydroxy(oxido)amino]propanoyloxy]-5-prop-2-enoyloxyoxan-2-yl]methyl 3-[hydroxy(oxido)amino]propanoate |
| SMILES | C=CC(=O)OC1C(O)OC(COC(=O)CCN([O-])O)C(OC(=O)CCN([O-])O)C1OC(=O)CCN([O-])O |
| InChI | InChI=1S/C18H26N3O16/c1-2-11(22)35-17-16(37-14(25)5-8-21(31)32)15(36-13(24)4-7-20(29)30)10(34-18(17)26)9-33-12(23)3-6-19(27)28/h2,10,15-18,26-27,29,31H,1,3-9H2/q-3 |
| InChIKey | ZTJQLLVEKZKXOP-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 274.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|