C15H21N3O15 — CID 14693833
[(2R,3S,4S,5R,6R)-3,4-dihydroxy-5,6-bis(3-nitropropanoyloxy)oxan-2-yl]methyl 3-nitropropanoate (PubChem CID 14693833) has the molecular formula C15H21N3O15 and a molecular weight of 483.34 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4-dihydroxy-5,6-bis(3-nitropropanoyloxy)oxan-2-yl]methyl 3-nitropropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4-dihydroxy-5,6-bis(3-nitropropanoyloxy)oxan-2-yl]methyl 3-nitropropanoate |
|---|---|
| PubChem CID | 14693833 |
| Molecular Formula | C15H21N3O15 |
| Molecular Weight | 483.34 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4-dihydroxy-5,6-bis(3-nitropropanoyloxy)oxan-2-yl]methyl 3-nitropropanoate |
| SMILES | O=C(CC[N+](=O)[O-])OC[C@H]1O[C@H](OC(=O)CC[N+](=O)[O-])[C@H](OC(=O)CC[N+](=O)[O-])[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H21N3O15/c19-9(1-4-16(24)25)30-7-8-12(22)13(23)14(32-10(20)2-5-17(26)27)15(31-8)33-11(21)3-6-18(28)29/h8,12-15,22-23H,1-7H2/t8-,12-,13+,14-,15-/m1/s1 |
| InChIKey | CNURKUNYCXCBEK-VIPIRZDLSA-N |
| XLogP | -2.57 |
| TPSA | 258.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.34 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|