C34H44N4O4 — CID 158796086
1-[(4S,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-[(4-phenylphenyl)methyl]-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3-propan-2-ylurea (PubChem CID 158796086) has the molecular formula C34H44N4O4 and a molecular weight of 572.75 g/mol. Its IUPAC name is 1-[(4S,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-[(4-phenylphenyl)methyl]-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3-propan-2-ylurea.
| Compound Name | 1-[(4S,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-[(4-phenylphenyl)methyl]-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 158796086 |
| Molecular Formula | C34H44N4O4 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | 1-[(4S,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-[(4-phenylphenyl)methyl]-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3-propan-2-ylurea |
| SMILES | CO[C@H]1CN(C)C(=O)c2cc(NC(=O)NC(C)C)ccc2OC[C@H](C)N(Cc2ccc(-c3ccccc3)cc2)C[C@@H]1C |
| InChI | InChI=1S/C34H44N4O4/c1-23(2)35-34(40)36-29-16-17-31-30(18-29)33(39)37(5)21-32(41-6)24(3)19-38(25(4)22-42-31)20-26-12-14-28(15-13-26)27-10-8-7-9-11-27/h7-18,23-25,32H,19-22H2,1-6H3,(H2,35,36,40)/t24-,25-,32-/m0/s1 |
| InChIKey | PRSAPQFXQBQJKY-CAHKVJEUSA-N |
| XLogP | 5.89 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |