C27H39N5O4 — CID 72725769
1-[(4S,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridin-4-ylmethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3-propan-2-ylurea (PubChem CID 72725769) has the molecular formula C27H39N5O4 and a molecular weight of 497.64 g/mol. Its IUPAC name is 1-[(4S,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridin-4-ylmethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3-propan-2-ylurea.
| Compound Name | 1-[(4S,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridin-4-ylmethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 72725769 |
| Molecular Formula | C27H39N5O4 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 1-[(4S,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridin-4-ylmethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3-propan-2-ylurea |
| SMILES | CO[C@H]1CN(C)C(=O)c2cc(NC(=O)NC(C)C)ccc2OC[C@H](C)N(Cc2ccncc2)C[C@@H]1C |
| InChI | InChI=1S/C27H39N5O4/c1-18(2)29-27(34)30-22-7-8-24-23(13-22)26(33)31(5)16-25(35-6)19(3)14-32(20(4)17-36-24)15-21-9-11-28-12-10-21/h7-13,18-20,25H,14-17H2,1-6H3,(H2,29,30,34)/t19-,20-,25-/m0/s1 |
| InChIKey | YYMKENCEBDDAER-RLSLOFABSA-N |
| XLogP | 3.62 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |