C25H34N4O4 — CID 71760640
N-[(4R,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridin-4-ylmethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]acetamide (PubChem CID 71760640) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-[(4R,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridin-4-ylmethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]acetamide.
| Compound Name | N-[(4R,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridin-4-ylmethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]acetamide |
|---|---|
| PubChem CID | 71760640 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | N-[(4R,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(pyridin-4-ylmethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]acetamide |
| SMILES | CO[C@H]1CN(C)C(=O)c2cc(NC(C)=O)ccc2OC[C@@H](C)N(Cc2ccncc2)C[C@@H]1C |
| InChI | InChI=1S/C25H34N4O4/c1-17-13-29(14-20-8-10-26-11-9-20)18(2)16-33-23-7-6-21(27-19(3)30)12-22(23)25(31)28(4)15-24(17)32-5/h6-12,17-18,24H,13-16H2,1-5H3,(H,27,30)/t17-,18+,24-/m0/s1 |
| InChIKey | XGJDEMLFYZDHTE-RHGYRFJNSA-N |
| XLogP | 3.05 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |