C27H37N3O4 — CID 54633668
N-[(4R,7S,8S)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(2-phenylethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]acetamide (PubChem CID 54633668) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is N-[(4R,7S,8S)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(2-phenylethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]acetamide.
| Compound Name | N-[(4R,7S,8S)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(2-phenylethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]acetamide |
|---|---|
| PubChem CID | 54633668 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | N-[(4R,7S,8S)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(2-phenylethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]acetamide |
| SMILES | CO[C@@H]1CN(C)C(=O)c2cc(NC(C)=O)ccc2OC[C@@H](C)N(CCc2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C27H37N3O4/c1-19-16-30(14-13-22-9-7-6-8-10-22)20(2)18-34-25-12-11-23(28-21(3)31)15-24(25)27(32)29(4)17-26(19)33-5/h6-12,15,19-20,26H,13-14,16-18H2,1-5H3,(H,28,31)/t19-,20+,26+/m0/s1 |
| InChIKey | ZQKSOPNYGIRHEN-OUDXUNEISA-N |
| XLogP | 3.69 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |