C33H41N3O5 — CID 54631788
3-methoxy-N-[(4S,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(2-phenylethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]benzamide (PubChem CID 54631788) has the molecular formula C33H41N3O5 and a molecular weight of 559.71 g/mol. Its IUPAC name is 3-methoxy-N-[(4S,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(2-phenylethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]benzamide.
| Compound Name | 3-methoxy-N-[(4S,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(2-phenylethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]benzamide |
|---|---|
| PubChem CID | 54631788 |
| Molecular Formula | C33H41N3O5 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | 3-methoxy-N-[(4S,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(2-phenylethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc3c(c2)C(=O)N(C)C[C@H](OC)[C@H](C)CN(CCc2ccccc2)[C@@H](C)CO3)c1 |
| InChI | InChI=1S/C33H41N3O5/c1-23-20-36(17-16-25-10-7-6-8-11-25)24(2)22-41-30-15-14-27(19-29(30)33(38)35(3)21-31(23)40-5)34-32(37)26-12-9-13-28(18-26)39-4/h6-15,18-19,23-24,31H,16-17,20-22H2,1-5H3,(H,34,37)/t23-,24+,31+/m1/s1 |
| InChIKey | OXAYHDRNXZXDOZ-OXYPMYLPSA-N |
| XLogP | 5.00 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |