C30H37N5O4 — CID 54636719
N-[(4R,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(2-phenylethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]pyrazine-2-carboxamide (PubChem CID 54636719) has the molecular formula C30H37N5O4 and a molecular weight of 531.66 g/mol. Its IUPAC name is N-[(4R,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(2-phenylethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(4R,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(2-phenylethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 54636719 |
| Molecular Formula | C30H37N5O4 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | N-[(4R,7R,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(2-phenylethyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]pyrazine-2-carboxamide |
| SMILES | CO[C@H]1CN(C)C(=O)c2cc(NC(=O)c3cnccn3)ccc2OC[C@@H](C)N(CCc2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C30H37N5O4/c1-21-18-35(15-12-23-8-6-5-7-9-23)22(2)20-39-27-11-10-24(33-29(36)26-17-31-13-14-32-26)16-25(27)30(37)34(3)19-28(21)38-4/h5-11,13-14,16-17,21-22,28H,12,15,18-20H2,1-4H3,(H,33,36)/t21-,22-,28+/m1/s1 |
| InChIKey | RLWOHOYDYFOQKM-XJGOYTCSSA-N |
| XLogP | 3.78 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |