C27H35N3O6 — CID 54635664
2-[[(4R,7R,8S)-14-acetamido-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-5-yl]methyl]benzoic acid (PubChem CID 54635664) has the molecular formula C27H35N3O6 and a molecular weight of 497.59 g/mol. Its IUPAC name is 2-[[(4R,7R,8S)-14-acetamido-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-5-yl]methyl]benzoic acid.
| Compound Name | 2-[[(4R,7R,8S)-14-acetamido-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-5-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 54635664 |
| Molecular Formula | C27H35N3O6 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 2-[[(4R,7R,8S)-14-acetamido-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-5-yl]methyl]benzoic acid |
| SMILES | CO[C@@H]1CN(C)C(=O)c2cc(NC(C)=O)ccc2OC[C@@H](C)N(Cc2ccccc2C(=O)O)C[C@H]1C |
| InChI | InChI=1S/C27H35N3O6/c1-17-13-30(14-20-8-6-7-9-22(20)27(33)34)18(2)16-36-24-11-10-21(28-19(3)31)12-23(24)26(32)29(4)15-25(17)35-5/h6-12,17-18,25H,13-16H2,1-5H3,(H,28,31)(H,33,34)/t17-,18-,25-/m1/s1 |
| InChIKey | YZVWCNZQOHIVOE-QJMRKGMQSA-N |
| XLogP | 3.35 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |