C26H33F2N3O4 — CID 54635545
N-[(4S,7R,8S)-5-[(2,5-difluorophenyl)methyl]-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]acetamide (PubChem CID 54635545) has the molecular formula C26H33F2N3O4 and a molecular weight of 489.56 g/mol. Its IUPAC name is N-[(4S,7R,8S)-5-[(2,5-difluorophenyl)methyl]-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]acetamide.
| Compound Name | N-[(4S,7R,8S)-5-[(2,5-difluorophenyl)methyl]-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]acetamide |
|---|---|
| PubChem CID | 54635545 |
| Molecular Formula | C26H33F2N3O4 |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | N-[(4S,7R,8S)-5-[(2,5-difluorophenyl)methyl]-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]acetamide |
| SMILES | CO[C@@H]1CN(C)C(=O)c2cc(NC(C)=O)ccc2OC[C@H](C)N(Cc2cc(F)ccc2F)C[C@H]1C |
| InChI | InChI=1S/C26H33F2N3O4/c1-16-12-31(13-19-10-20(27)6-8-23(19)28)17(2)15-35-24-9-7-21(29-18(3)32)11-22(24)26(33)30(4)14-25(16)34-5/h6-11,16-17,25H,12-15H2,1-5H3,(H,29,32)/t16-,17+,25-/m1/s1 |
| InChIKey | LLAXLEBVNQPREO-LEHBWIKQSA-N |
| XLogP | 3.93 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |