C27H38N4O4 — CID 166788415
1-[(7S,8R)-5-benzyl-8-methoxy-7,10-dimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3-propan-2-ylurea (PubChem CID 166788415) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is 1-[(7S,8R)-5-benzyl-8-methoxy-7,10-dimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3-propan-2-ylurea.
| Compound Name | 1-[(7S,8R)-5-benzyl-8-methoxy-7,10-dimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 166788415 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 1-[(7S,8R)-5-benzyl-8-methoxy-7,10-dimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3-propan-2-ylurea |
| SMILES | CO[C@H]1CN(C)C(=O)c2cc(NC(=O)NC(C)C)ccc2OCCN(Cc2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C27H38N4O4/c1-19(2)28-27(33)29-22-11-12-24-23(15-22)26(32)30(4)18-25(34-5)20(3)16-31(13-14-35-24)17-21-9-7-6-8-10-21/h6-12,15,19-20,25H,13-14,16-18H2,1-5H3,(H2,28,29,33)/t20-,25-/m0/s1 |
| InChIKey | HGHMHTTXFGOFFE-CPJSRVTESA-N |
| XLogP | 3.83 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |