C35H34O4 — CID 158796502
1,3-diphenylpentane-1,4-dione;(E)-1,3-diphenylprop-2-en-1-one;propanal (PubChem CID 158796502) has the molecular formula C35H34O4 and a molecular weight of 518.65 g/mol. Its IUPAC name is 1,3-diphenylpentane-1,4-dione;(E)-1,3-diphenylprop-2-en-1-one;propanal.
| Compound Name | 1,3-diphenylpentane-1,4-dione;(E)-1,3-diphenylprop-2-en-1-one;propanal |
|---|---|
| PubChem CID | 158796502 |
| Molecular Formula | C35H34O4 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 1,3-diphenylpentane-1,4-dione;(E)-1,3-diphenylprop-2-en-1-one;propanal |
| SMILES | CC(=O)C(CC(=O)c1ccccc1)c1ccccc1.CCC=O.O=C(/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16O2.C15H12O.C3H6O/c1-13(18)16(14-8-4-2-5-9-14)12-17(19)15-10-6-3-7-11-15;16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13;1-2-3-4/h2-11,16H,12H2,1H3;1-12H;3H,2H2,1H3/b;12-11+; |
| InChIKey | ISXRNNAXKCEVCK-ITTKMUPFSA-N |
| XLogP | 7.81 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|